C22H24N2O3S — CID 17376956
1-[(3,4-dimethoxyphenyl)methyl]-1-(furan-2-ylmethyl)-3-(4-methylphenyl)thiourea (PubChem CID 17376956) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is 1-[(3,4-dimethoxyphenyl)methyl]-1-(furan-2-ylmethyl)-3-(4-methylphenyl)thiourea.
| Compound Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(furan-2-ylmethyl)-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17376956 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-1-(furan-2-ylmethyl)-3-(4-methylphenyl)thiourea |
| SMILES | COc1ccc(CN(Cc2ccco2)C(=S)Nc2ccc(C)cc2)cc1OC |
| InChI | InChI=1S/C22H24N2O3S/c1-16-6-9-18(10-7-16)23-22(28)24(15-19-5-4-12-27-19)14-17-8-11-20(25-2)21(13-17)26-3/h4-13H,14-15H2,1-3H3,(H,23,28) |
| InChIKey | CAUJNVXWXXHWFT-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 46.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|