C23H26N2O2S — CID 5099180
1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxy-5-methylphenyl)thiourea (PubChem CID 5099180) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is 1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxy-5-methylphenyl)thiourea.
| Compound Name | 1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxy-5-methylphenyl)thiourea |
|---|---|
| PubChem CID | 5099180 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 1-[(4-ethylphenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methoxy-5-methylphenyl)thiourea |
| SMILES | CCc1ccc(CN(Cc2ccco2)C(=S)Nc2cc(C)ccc2OC)cc1 |
| InChI | InChI=1S/C23H26N2O2S/c1-4-18-8-10-19(11-9-18)15-25(16-20-6-5-13-27-20)23(28)24-21-14-17(2)7-12-22(21)26-3/h5-14H,4,15-16H2,1-3H3,(H,24,28) |
| InChIKey | ZRCREBPMLJCIAQ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|