C23H26N2O4S — CID 4299821
1-[(2,5-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea (PubChem CID 4299821) has the molecular formula C23H26N2O4S and a molecular weight of 426.54 g/mol. Its IUPAC name is 1-[(2,5-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[(2,5-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4299821 |
| Molecular Formula | C23H26N2O4S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[(2,5-dimethoxyphenyl)methyl]-3-(2-ethoxyphenyl)-1-(furan-2-ylmethyl)thiourea |
| SMILES | CCOc1ccccc1NC(=S)N(Cc1ccco1)Cc1cc(OC)ccc1OC |
| InChI | InChI=1S/C23H26N2O4S/c1-4-28-22-10-6-5-9-20(22)24-23(30)25(16-19-8-7-13-29-19)15-17-14-18(26-2)11-12-21(17)27-3/h5-14H,4,15-16H2,1-3H3,(H,24,30) |
| InChIKey | JXFJZNIKHZDIOY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 56.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|