C20H19ClN2O2S — CID 4143601
1-[(4-chlorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(3-methoxyphenyl)thiourea (PubChem CID 4143601) has the molecular formula C20H19ClN2O2S and a molecular weight of 386.90 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 4143601 |
| Molecular Formula | C20H19ClN2O2S |
| Molecular Weight | 386.90 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(Cc2ccc(Cl)cc2)Cc2ccco2)c1 |
| InChI | InChI=1S/C20H19ClN2O2S/c1-24-18-5-2-4-17(12-18)22-20(26)23(14-19-6-3-11-25-19)13-15-7-9-16(21)10-8-15/h2-12H,13-14H2,1H3,(H,22,26) |
| InChIKey | IBAFDTXHBMFPGS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 37.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.90 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|