C24H27N3OS — CID 3656615
1-benzyl-1-[[4-(dimethylamino)phenyl]methyl]-3-(3-methoxyphenyl)thiourea (PubChem CID 3656615) has the molecular formula C24H27N3OS and a molecular weight of 405.57 g/mol. Its IUPAC name is 1-benzyl-1-[[4-(dimethylamino)phenyl]methyl]-3-(3-methoxyphenyl)thiourea.
| Compound Name | 1-benzyl-1-[[4-(dimethylamino)phenyl]methyl]-3-(3-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3656615 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 1-benzyl-1-[[4-(dimethylamino)phenyl]methyl]-3-(3-methoxyphenyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(Cc2ccccc2)Cc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C24H27N3OS/c1-26(2)22-14-12-20(13-15-22)18-27(17-19-8-5-4-6-9-19)24(29)25-21-10-7-11-23(16-21)28-3/h4-16H,17-18H2,1-3H3,(H,25,29) |
| InChIKey | FQOPYEVYXGVJMD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|