C20H20N2OS2 — CID 4164397
1-benzyl-3-(3-methoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea (PubChem CID 4164397) has the molecular formula C20H20N2OS2 and a molecular weight of 368.53 g/mol. Its IUPAC name is 1-benzyl-3-(3-methoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-3-(3-methoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 4164397 |
| Molecular Formula | C20H20N2OS2 |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-benzyl-3-(3-methoxyphenyl)-1-(thiophen-2-ylmethyl)thiourea |
| SMILES | COc1cccc(NC(=S)N(Cc2ccccc2)Cc2cccs2)c1 |
| InChI | InChI=1S/C20H20N2OS2/c1-23-18-10-5-9-17(13-18)21-20(24)22(15-19-11-6-12-25-19)14-16-7-3-2-4-8-16/h2-13H,14-15H2,1H3,(H,21,24) |
| InChIKey | UBZRHKFUIJZBNR-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|