C19H24N2O5S — CID 3862055
ethyl 3-[(2,5-dimethoxyphenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate (PubChem CID 3862055) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is ethyl 3-[(2,5-dimethoxyphenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[(2,5-dimethoxyphenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 3862055 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | ethyl 3-[(2,5-dimethoxyphenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)C(=S)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H24N2O5S/c1-4-25-18(22)9-10-21(13-15-6-5-11-26-15)19(27)20-16-12-14(23-2)7-8-17(16)24-3/h5-8,11-12H,4,9-10,13H2,1-3H3,(H,20,27) |
| InChIKey | FVTPOGZMXLNOGB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|