C19H23N3O4S — CID 3834967
ethyl 2-[(2,5-dimethoxyphenyl)carbamothioyl-(pyridin-2-ylmethyl)amino]acetate (PubChem CID 3834967) has the molecular formula C19H23N3O4S and a molecular weight of 389.48 g/mol. Its IUPAC name is ethyl 2-[(2,5-dimethoxyphenyl)carbamothioyl-(pyridin-2-ylmethyl)amino]acetate.
| Compound Name | ethyl 2-[(2,5-dimethoxyphenyl)carbamothioyl-(pyridin-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 3834967 |
| Molecular Formula | C19H23N3O4S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | ethyl 2-[(2,5-dimethoxyphenyl)carbamothioyl-(pyridin-2-ylmethyl)amino]acetate |
| SMILES | CCOC(=O)CN(Cc1ccccn1)C(=S)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H23N3O4S/c1-4-26-18(23)13-22(12-14-7-5-6-10-20-14)19(27)21-16-11-15(24-2)8-9-17(16)25-3/h5-11H,4,12-13H2,1-3H3,(H,21,27) |
| InChIKey | YSPYOLSLEVAYJU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|