C12H17NO4 — CID 28576005
ethyl 2-(2,5-dimethoxyanilino)acetate (PubChem CID 28576005) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 2-(2,5-dimethoxyanilino)acetate.
| Compound Name | ethyl 2-(2,5-dimethoxyanilino)acetate |
|---|---|
| PubChem CID | 28576005 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 2-(2,5-dimethoxyanilino)acetate |
| SMILES | CCOC(=O)CNc1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H17NO4/c1-4-17-12(14)8-13-10-7-9(15-2)5-6-11(10)16-3/h5-7,13H,4,8H2,1-3H3 |
| InChIKey | MVYFXBRXBFASGU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |