C14H21NO4 — CID 115257468
ethyl 2-[2-(2,5-dimethoxyphenyl)ethylamino]acetate (PubChem CID 115257468) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is ethyl 2-[2-(2,5-dimethoxyphenyl)ethylamino]acetate.
| Compound Name | ethyl 2-[2-(2,5-dimethoxyphenyl)ethylamino]acetate |
|---|---|
| PubChem CID | 115257468 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | ethyl 2-[2-(2,5-dimethoxyphenyl)ethylamino]acetate |
| SMILES | CCOC(=O)CNCCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H21NO4/c1-4-19-14(16)10-15-8-7-11-9-12(17-2)5-6-13(11)18-3/h5-6,9,15H,4,7-8,10H2,1-3H3 |
| InChIKey | KUPGXJYTBXBKTK-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|