C12H20N2O2 — CID 115227129
N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-methylmethanediamine (PubChem CID 115227129) has the molecular formula C12H20N2O2 and a molecular weight of 224.30 g/mol. Its IUPAC name is N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-methylmethanediamine.
| Compound Name | N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-methylmethanediamine |
|---|---|
| PubChem CID | 115227129 |
| Molecular Formula | C12H20N2O2 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | N'-[2-(2,5-dimethoxyphenyl)ethyl]-N-methylmethanediamine |
| SMILES | CNCNCCc1cc(OC)ccc1OC |
| InChI | InChI=1S/C12H20N2O2/c1-13-9-14-7-6-10-8-11(15-2)4-5-12(10)16-3/h4-5,8,13-14H,6-7,9H2,1-3H3 |
| InChIKey | ZHJJFMHFHHWXJG-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|