C11H17FN2O — CID 115227132
N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]-N-methylmethanediamine (PubChem CID 115227132) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]-N-methylmethanediamine.
| Compound Name | N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]-N-methylmethanediamine |
|---|---|
| PubChem CID | 115227132 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]-N-methylmethanediamine |
| SMILES | CNCNCCc1cc(F)ccc1OC |
| InChI | InChI=1S/C11H17FN2O/c1-13-8-14-6-5-9-7-10(12)3-4-11(9)15-2/h3-4,7,13-14H,5-6,8H2,1-2H3 |
| InChIKey | SBWNHOHMQLIRNI-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|