C13H21FN2O — CID 115205971
N-ethyl-N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine (PubChem CID 115205971) has the molecular formula C13H21FN2O and a molecular weight of 240.32 g/mol. Its IUPAC name is N-ethyl-N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine.
| Compound Name | N-ethyl-N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 115205971 |
| Molecular Formula | C13H21FN2O |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | N-ethyl-N'-[2-(5-fluoro-2-methoxyphenyl)ethyl]ethane-1,2-diamine |
| SMILES | CCNCCNCCc1cc(F)ccc1OC |
| InChI | InChI=1S/C13H21FN2O/c1-3-15-8-9-16-7-6-11-10-12(14)4-5-13(11)17-2/h4-5,10,15-16H,3,6-9H2,1-2H3 |
| InChIKey | AWRPGZOCGNSUAF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|