C14H23FN2O — CID 115203997
1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]pentane-1,4-diamine (PubChem CID 115203997) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]pentane-1,4-diamine.
| Compound Name | 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 115203997 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]pentane-1,4-diamine |
| SMILES | COc1ccc(F)cc1CCNCCCC(C)N |
| InChI | InChI=1S/C14H23FN2O/c1-11(16)4-3-8-17-9-7-12-10-13(15)5-6-14(12)18-2/h5-6,10-11,17H,3-4,7-9,16H2,1-2H3 |
| InChIKey | QDWBBXFOTXOSCW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|