C12H19FN2O — CID 115196753
1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]propane-1,2-diamine (PubChem CID 115196753) has the molecular formula C12H19FN2O and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]propane-1,2-diamine.
| Compound Name | 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 115196753 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 1-N-[2-(5-fluoro-2-methoxyphenyl)ethyl]propane-1,2-diamine |
| SMILES | COc1ccc(F)cc1CCNCC(C)N |
| InChI | InChI=1S/C12H19FN2O/c1-9(14)8-15-6-5-10-7-11(13)3-4-12(10)16-2/h3-4,7,9,15H,5-6,8,14H2,1-2H3 |
| InChIKey | UTLRYHATGABZSI-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|