C23H27N3O3 — CID 174411447
2-(2,5-dimethoxyanilino)-N-phenylacetamide;2-methylaniline (PubChem CID 174411447) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-N-phenylacetamide;2-methylaniline.
| Compound Name | 2-(2,5-dimethoxyanilino)-N-phenylacetamide;2-methylaniline |
|---|---|
| PubChem CID | 174411447 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)-N-phenylacetamide;2-methylaniline |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2ccccc2)c1.Cc1ccccc1N |
| InChI | InChI=1S/C16H18N2O3.C7H9N/c1-20-13-8-9-15(21-2)14(10-13)17-11-16(19)18-12-6-4-3-5-7-12;1-6-4-2-3-5-7(6)8/h3-10,17H,11H2,1-2H3,(H,18,19);2-5H,8H2,1H3 |
| InChIKey | DKESNYSWNFZANJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|