C24H25N3O4 — CID 54814112
4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methyl-N-phenylbenzamide (PubChem CID 54814112) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methyl-N-phenylbenzamide.
| Compound Name | 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methyl-N-phenylbenzamide |
|---|---|
| PubChem CID | 54814112 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methyl-N-phenylbenzamide |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2ccc(C(=O)N(C)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C24H25N3O4/c1-27(19-7-5-4-6-8-19)24(29)17-9-11-18(12-10-17)26-23(28)16-25-21-15-20(30-2)13-14-22(21)31-3/h4-15,25H,16H2,1-3H3,(H,26,28) |
| InChIKey | UUPAQEIIUGTBMY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |