C18H21N3O4 — CID 54814140
4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide (PubChem CID 54814140) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide.
| Compound Name | 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54814140 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(NC(=O)CNc2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-19-18(23)12-4-6-13(7-5-12)21-17(22)11-20-15-10-14(24-2)8-9-16(15)25-3/h4-10,20H,11H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | GSFMISWQBDDXEG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |