C25H27N3O4 — CID 54813928
N-benzyl-3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide (PubChem CID 54813928) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-benzyl-3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54813928 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | N-benzyl-3-[[2-(2,5-dimethoxyanilino)acetyl]amino]-N-methylbenzamide |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2cccc(C(=O)N(C)Cc3ccccc3)c2)c1 |
| InChI | InChI=1S/C25H27N3O4/c1-28(17-18-8-5-4-6-9-18)25(30)19-10-7-11-20(14-19)27-24(29)16-26-22-15-21(31-2)12-13-23(22)32-3/h4-15,26H,16-17H2,1-3H3,(H,27,29) |
| InChIKey | WDZPTZCBHGGWQP-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |