C23H21Cl2N3O2 — CID 54816093
N-benzyl-3-[[2-(2,3-dichloroanilino)acetyl]amino]-N-methylbenzamide (PubChem CID 54816093) has the molecular formula C23H21Cl2N3O2 and a molecular weight of 442.35 g/mol. Its IUPAC name is N-benzyl-3-[[2-(2,3-dichloroanilino)acetyl]amino]-N-methylbenzamide.
| Compound Name | N-benzyl-3-[[2-(2,3-dichloroanilino)acetyl]amino]-N-methylbenzamide |
|---|---|
| PubChem CID | 54816093 |
| Molecular Formula | C23H21Cl2N3O2 |
| Molecular Weight | 442.35 g/mol |
| Exact Mass | 441.10 |
| IUPAC Name | N-benzyl-3-[[2-(2,3-dichloroanilino)acetyl]amino]-N-methylbenzamide |
| SMILES | CN(Cc1ccccc1)C(=O)c1cccc(NC(=O)CNc2cccc(Cl)c2Cl)c1 |
| InChI | InChI=1S/C23H21Cl2N3O2/c1-28(15-16-7-3-2-4-8-16)23(30)17-9-5-10-18(13-17)27-21(29)14-26-20-12-6-11-19(24)22(20)25/h2-13,26H,14-15H2,1H3,(H,27,29) |
| InChIKey | HZNDEPJJLMLTPY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.35 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |