C24H26N2O5 — CID 54814109
2-(2,5-dimethoxyanilino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide (PubChem CID 54814109) has the molecular formula C24H26N2O5 and a molecular weight of 422.48 g/mol. Its IUPAC name is 2-(2,5-dimethoxyanilino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(2,5-dimethoxyanilino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 54814109 |
| Molecular Formula | C24H26N2O5 |
| Molecular Weight | 422.48 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 2-(2,5-dimethoxyanilino)-N-[3-(2-phenoxyethoxy)phenyl]acetamide |
| SMILES | COc1ccc(OC)c(NCC(=O)Nc2cccc(OCCOc3ccccc3)c2)c1 |
| InChI | InChI=1S/C24H26N2O5/c1-28-20-11-12-23(29-2)22(16-20)25-17-24(27)26-18-7-6-10-21(15-18)31-14-13-30-19-8-4-3-5-9-19/h3-12,15-16,25H,13-14,17H2,1-2H3,(H,26,27) |
| InChIKey | FZWBQJRPZVCHBS-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|