C18H19N3O3S — CID 3780932
ethyl 3-[(3-cyanophenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate (PubChem CID 3780932) has the molecular formula C18H19N3O3S and a molecular weight of 357.44 g/mol. Its IUPAC name is ethyl 3-[(3-cyanophenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate.
| Compound Name | ethyl 3-[(3-cyanophenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate |
|---|---|
| PubChem CID | 3780932 |
| Molecular Formula | C18H19N3O3S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | ethyl 3-[(3-cyanophenyl)carbamothioyl-(furan-2-ylmethyl)amino]propanoate |
| SMILES | CCOC(=O)CCN(Cc1ccco1)C(=S)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C18H19N3O3S/c1-2-23-17(22)8-9-21(13-16-7-4-10-24-16)18(25)20-15-6-3-5-14(11-15)12-19/h3-7,10-11H,2,8-9,13H2,1H3,(H,20,25) |
| InChIKey | RBZZTFIWDHYWHA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 78.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|