C17H15FN2O2S — CID 8727183
3-(2-fluorophenyl)-1,1-bis(furan-2-ylmethyl)thiourea (PubChem CID 8727183) has the molecular formula C17H15FN2O2S and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-(2-fluorophenyl)-1,1-bis(furan-2-ylmethyl)thiourea.
| Compound Name | 3-(2-fluorophenyl)-1,1-bis(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 8727183 |
| Molecular Formula | C17H15FN2O2S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 3-(2-fluorophenyl)-1,1-bis(furan-2-ylmethyl)thiourea |
| SMILES | Fc1ccccc1NC(=S)N(Cc1ccco1)Cc1ccco1 |
| InChI | InChI=1S/C17H15FN2O2S/c18-15-7-1-2-8-16(15)19-17(23)20(11-13-5-3-9-21-13)12-14-6-4-10-22-14/h1-10H,11-12H2,(H,19,23) |
| InChIKey | FLXPKECPIVAAMC-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|