C20H19FN2OS — CID 17388192
1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methylphenyl)thiourea (PubChem CID 17388192) has the molecular formula C20H19FN2OS and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 17388192 |
| Molecular Formula | C20H19FN2OS |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-(furan-2-ylmethyl)-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)N(Cc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C20H19FN2OS/c1-15-5-2-3-7-19(15)22-20(25)23(14-18-6-4-12-24-18)13-16-8-10-17(21)11-9-16/h2-12H,13-14H2,1H3,(H,22,25) |
| InChIKey | DHGJBPPIYDAOCM-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|