C21H22N2O2S — CID 8679460
3-(3,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]thiourea (PubChem CID 8679460) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]thiourea.
| Compound Name | 3-(3,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 8679460 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-(furan-2-ylmethyl)-1-[(2-hydroxyphenyl)methyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)N(Cc2ccco2)Cc2ccccc2O)c1 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-10-16(2)12-18(11-15)22-21(26)23(14-19-7-5-9-25-19)13-17-6-3-4-8-20(17)24/h3-12,24H,13-14H2,1-2H3,(H,22,26) |
| InChIKey | NNOIUXRXSYUJNU-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|