C22H23NO3 — CID 134032585
N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(3-methylphenyl)propanamide (PubChem CID 134032585) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(3-methylphenyl)propanamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 134032585 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)N(Cc2ccco2)Cc2ccccc2O)c1 |
| InChI | InChI=1S/C22H23NO3/c1-17-6-4-7-18(14-17)11-12-22(25)23(16-20-9-5-13-26-20)15-19-8-2-3-10-21(19)24/h2-10,13-14,24H,11-12,15-16H2,1H3 |
| InChIKey | BHHNSZPSQMXNLQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|