C19H25NO3 — CID 96518313
(3R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-methylhexanamide (PubChem CID 96518313) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (3R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-methylhexanamide.
| Compound Name | (3R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-methylhexanamide |
|---|---|
| PubChem CID | 96518313 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (3R)-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-methylhexanamide |
| SMILES | CCC[C@@H](C)CC(=O)N(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C19H25NO3/c1-3-7-15(2)12-19(22)20(14-17-9-6-11-23-17)13-16-8-4-5-10-18(16)21/h4-6,8-11,15,21H,3,7,12-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | XCRKXCHKIFLGPQ-OAHLLOKOSA-N |
| XLogP | 4.34 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|