C19H26N2O3 — CID 78820887
2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]-N-pentylacetamide (PubChem CID 78820887) has the molecular formula C19H26N2O3 and a molecular weight of 330.43 g/mol. Its IUPAC name is 2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]-N-pentylacetamide.
| Compound Name | 2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]-N-pentylacetamide |
|---|---|
| PubChem CID | 78820887 |
| Molecular Formula | C19H26N2O3 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[furan-2-ylmethyl-[(2-hydroxyphenyl)methyl]amino]-N-pentylacetamide |
| SMILES | CCCCCNC(=O)CN(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C19H26N2O3/c1-2-3-6-11-20-19(23)15-21(14-17-9-7-12-24-17)13-16-8-4-5-10-18(16)22/h4-5,7-10,12,22H,2-3,6,11,13-15H2,1H3,(H,20,23) |
| InChIKey | IGKIQPUFIMOQFU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|