C15H27NO — CID 86163523
N-(furan-2-ylmethyl)-N-pentylpentan-1-amine (PubChem CID 86163523) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-pentylpentan-1-amine.
| Compound Name | N-(furan-2-ylmethyl)-N-pentylpentan-1-amine |
|---|---|
| PubChem CID | 86163523 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-pentylpentan-1-amine |
| SMILES | CCCCCN(CCCCC)Cc1ccco1 |
| InChI | InChI=1S/C15H27NO/c1-3-5-7-11-16(12-8-6-4-2)14-15-10-9-13-17-15/h9-10,13H,3-8,11-12,14H2,1-2H3 |
| InChIKey | UEQAPDCAXBQYBX-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|