C10H13NO — CID 60970119
N-ethyl-N-(furan-2-ylmethyl)prop-2-yn-1-amine (PubChem CID 60970119) has the molecular formula C10H13NO and a molecular weight of 163.22 g/mol. Its IUPAC name is N-ethyl-N-(furan-2-ylmethyl)prop-2-yn-1-amine.
| Compound Name | N-ethyl-N-(furan-2-ylmethyl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 60970119 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | N-ethyl-N-(furan-2-ylmethyl)prop-2-yn-1-amine |
| SMILES | C#CCN(CC)Cc1ccco1 |
| InChI | InChI=1S/C10H13NO/c1-3-7-11(4-2)9-10-6-5-8-12-10/h1,5-6,8H,4,7,9H2,2H3 |
| InChIKey | NBHJFFZSNXPPHM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|