C13H17NO3 — CID 56791574
methyl 4-[furan-2-ylmethyl(prop-2-ynyl)amino]butanoate (PubChem CID 56791574) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is methyl 4-[furan-2-ylmethyl(prop-2-ynyl)amino]butanoate.
| Compound Name | methyl 4-[furan-2-ylmethyl(prop-2-ynyl)amino]butanoate |
|---|---|
| PubChem CID | 56791574 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | methyl 4-[furan-2-ylmethyl(prop-2-ynyl)amino]butanoate |
| SMILES | C#CCN(CCCC(=O)OC)Cc1ccco1 |
| InChI | InChI=1S/C13H17NO3/c1-3-8-14(9-4-7-13(15)16-2)11-12-6-5-10-17-12/h1,5-6,10H,4,7-9,11H2,2H3 |
| InChIKey | NVEFDQRCWXJXPS-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|