C14H22N2O4 — CID 62012537
methyl 2-[[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-propylamino]acetate (PubChem CID 62012537) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 2-[[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-propylamino]acetate.
| Compound Name | methyl 2-[[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-propylamino]acetate |
|---|---|
| PubChem CID | 62012537 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 2-[[2-[furan-2-ylmethyl(methyl)amino]-2-oxoethyl]-propylamino]acetate |
| SMILES | CCCN(CC(=O)OC)CC(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-4-7-16(11-14(18)19-3)10-13(17)15(2)9-12-6-5-8-20-12/h5-6,8H,4,7,9-11H2,1-3H3 |
| InChIKey | RBBJAOOUCPUTKB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |