C13H23NO3 — CID 63619200
2,2-diethoxy-N-ethyl-N-(furan-2-ylmethyl)ethanamine (PubChem CID 63619200) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is 2,2-diethoxy-N-ethyl-N-(furan-2-ylmethyl)ethanamine.
| Compound Name | 2,2-diethoxy-N-ethyl-N-(furan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 63619200 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | 2,2-diethoxy-N-ethyl-N-(furan-2-ylmethyl)ethanamine |
| SMILES | CCOC(CN(CC)Cc1ccco1)OCC |
| InChI | InChI=1S/C13H23NO3/c1-4-14(10-12-8-7-9-17-12)11-13(15-5-2)16-6-3/h7-9,13H,4-6,10-11H2,1-3H3 |
| InChIKey | HQUYLOPNTNTIMY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 34.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|