C13H24N2O2 — CID 61423306
1-[ethyl(furan-2-ylmethyl)amino]-3-(propan-2-ylamino)propan-2-ol (PubChem CID 61423306) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-[ethyl(furan-2-ylmethyl)amino]-3-(propan-2-ylamino)propan-2-ol.
| Compound Name | 1-[ethyl(furan-2-ylmethyl)amino]-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| PubChem CID | 61423306 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-[ethyl(furan-2-ylmethyl)amino]-3-(propan-2-ylamino)propan-2-ol |
| SMILES | CCN(Cc1ccco1)CC(O)CNC(C)C |
| InChI | InChI=1S/C13H24N2O2/c1-4-15(10-13-6-5-7-17-13)9-12(16)8-14-11(2)3/h5-7,11-12,14,16H,4,8-10H2,1-3H3 |
| InChIKey | LYZOYUVTCBLDFU-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 48.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |