C11H19NO2 — CID 61423764
1-[ethyl(furan-2-ylmethyl)amino]butan-2-ol (PubChem CID 61423764) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-[ethyl(furan-2-ylmethyl)amino]butan-2-ol.
| Compound Name | 1-[ethyl(furan-2-ylmethyl)amino]butan-2-ol |
|---|---|
| PubChem CID | 61423764 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-[ethyl(furan-2-ylmethyl)amino]butan-2-ol |
| SMILES | CCC(O)CN(CC)Cc1ccco1 |
| InChI | InChI=1S/C11H19NO2/c1-3-10(13)8-12(4-2)9-11-6-5-7-14-11/h5-7,10,13H,3-4,8-9H2,1-2H3 |
| InChIKey | KZVRHZJMWFLAIY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 36.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |