C19H29NO5S — CID 74226498
1-[2,2-diethoxyethyl(thiophen-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol (PubChem CID 74226498) has the molecular formula C19H29NO5S and a molecular weight of 383.51 g/mol. Its IUPAC name is 1-[2,2-diethoxyethyl(thiophen-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[2,2-diethoxyethyl(thiophen-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 74226498 |
| Molecular Formula | C19H29NO5S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[2,2-diethoxyethyl(thiophen-2-ylmethyl)amino]-3-(furan-2-ylmethoxy)propan-2-ol |
| SMILES | CCOC(CN(Cc1cccs1)CC(O)COCc1ccco1)OCC |
| InChI | InChI=1S/C19H29NO5S/c1-3-23-19(24-4-2)13-20(12-18-8-6-10-26-18)11-16(21)14-22-15-17-7-5-9-25-17/h5-10,16,19,21H,3-4,11-15H2,1-2H3 |
| InChIKey | XCQOYEKOCGNLBB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 64.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|