C24H28N2O4 — CID 18271937
2-[benzyl(furan-2-ylmethyl)amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide (PubChem CID 18271937) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is 2-[benzyl(furan-2-ylmethyl)amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 18271937 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[benzyl(furan-2-ylmethyl)amino]-N-[2-(4-ethoxyphenoxy)ethyl]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)CN(Cc2ccccc2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-2-28-21-10-12-22(13-11-21)30-16-14-25-24(27)19-26(18-23-9-6-15-29-23)17-20-7-4-3-5-8-20/h3-13,15H,2,14,16-19H2,1H3,(H,25,27) |
| InChIKey | FQCMAXRPUJNSGL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|