C24H24N2O5 — CID 134032583
N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanamide (PubChem CID 134032583) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanamide.
| Compound Name | N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanamide |
|---|---|
| PubChem CID | 134032583 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]-3-(2-methyl-3-oxo-1,4-benzoxazin-4-yl)propanamide |
| SMILES | CC1Oc2ccccc2N(CCC(=O)N(Cc2ccco2)Cc2ccccc2O)C1=O |
| InChI | InChI=1S/C24H24N2O5/c1-17-24(29)26(20-9-3-5-11-22(20)31-17)13-12-23(28)25(16-19-8-6-14-30-19)15-18-7-2-4-10-21(18)27/h2-11,14,17,27H,12-13,15-16H2,1H3 |
| InChIKey | YELUFIXSVXDPGP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|