C19H15F2NO3 — CID 78798707
2,4-difluoro-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]benzamide (PubChem CID 78798707) has the molecular formula C19H15F2NO3 and a molecular weight of 343.33 g/mol. Its IUPAC name is 2,4-difluoro-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]benzamide.
| Compound Name | 2,4-difluoro-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 78798707 |
| Molecular Formula | C19H15F2NO3 |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 2,4-difluoro-N-(furan-2-ylmethyl)-N-[(2-hydroxyphenyl)methyl]benzamide |
| SMILES | O=C(c1ccc(F)cc1F)N(Cc1ccco1)Cc1ccccc1O |
| InChI | InChI=1S/C19H15F2NO3/c20-14-7-8-16(17(21)10-14)19(24)22(12-15-5-3-9-25-15)11-13-4-1-2-6-18(13)23/h1-10,23H,11-12H2 |
| InChIKey | OVNFRVRYIFPISB-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|