C25H19F2NO5S — CID 3945554
[4-[[(2-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3945554) has the molecular formula C25H19F2NO5S and a molecular weight of 483.49 g/mol. Its IUPAC name is [4-[[(2-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(2-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3945554 |
| Molecular Formula | C25H19F2NO5S |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | [4-[[(2-fluorobenzoyl)-(furan-2-ylmethyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(c1ccccc1F)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C25H19F2NO5S/c26-19-9-13-22(14-10-19)34(30,31)33-20-11-7-18(8-12-20)16-28(17-21-4-3-15-32-21)25(29)23-5-1-2-6-24(23)27/h1-15H,16-17H2 |
| InChIKey | AJGSRSZKSDRUMZ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|