C32H32F2N2O5S — CID 46135668
[5-(diethylamino)-2-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate (PubChem CID 46135668) has the molecular formula C32H32F2N2O5S and a molecular weight of 594.68 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
|---|---|
| PubChem CID | 46135668 |
| Molecular Formula | C32H32F2N2O5S |
| Molecular Weight | 594.68 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | [5-(diethylamino)-2-[[(2-fluorobenzoyl)-[(4-fluorophenyl)methyl]amino]methyl]phenyl] 4-methoxybenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(Cc2ccc(F)cc2)C(=O)c2ccccc2F)c(OS(=O)(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C32H32F2N2O5S/c1-4-35(5-2)26-15-12-24(31(20-26)41-42(38,39)28-18-16-27(40-3)17-19-28)22-36(21-23-10-13-25(33)14-11-23)32(37)29-8-6-7-9-30(29)34/h6-20H,4-5,21-22H2,1-3H3 |
| InChIKey | YUDBXGKJMQIKTF-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.68 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|