C24H33FN2O4S — CID 93302234
[2-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate (PubChem CID 93302234) has the molecular formula C24H33FN2O4S and a molecular weight of 464.60 g/mol. Its IUPAC name is [2-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate.
| Compound Name | [2-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 93302234 |
| Molecular Formula | C24H33FN2O4S |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | [2-[[[(2R)-butan-2-yl]-(2-fluorobenzoyl)amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate |
| SMILES | CC[C@@H](C)N(Cc1ccc(N(CC)CC)cc1OS(=O)(=O)CC)C(=O)c1ccccc1F |
| InChI | InChI=1S/C24H33FN2O4S/c1-6-18(5)27(24(28)21-12-10-11-13-22(21)25)17-19-14-15-20(26(7-2)8-3)16-23(19)31-32(29,30)9-4/h10-16,18H,6-9,17H2,1-5H3/t18-/m1/s1 |
| InChIKey | GPXSPMHQPXANLG-GOSISDBHSA-N |
| XLogP | 4.84 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|