C21H37N3O4S — CID 46111020
[2-[[butanoyl-[2-(dimethylamino)ethyl]amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate (PubChem CID 46111020) has the molecular formula C21H37N3O4S and a molecular weight of 427.61 g/mol. Its IUPAC name is [2-[[butanoyl-[2-(dimethylamino)ethyl]amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate.
| Compound Name | [2-[[butanoyl-[2-(dimethylamino)ethyl]amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 46111020 |
| Molecular Formula | C21H37N3O4S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | [2-[[butanoyl-[2-(dimethylamino)ethyl]amino]methyl]-5-(diethylamino)phenyl] ethanesulfonate |
| SMILES | CCCC(=O)N(CCN(C)C)Cc1ccc(N(CC)CC)cc1OS(=O)(=O)CC |
| InChI | InChI=1S/C21H37N3O4S/c1-7-11-21(25)24(15-14-22(5)6)17-18-12-13-19(23(8-2)9-3)16-20(18)28-29(26,27)10-4/h12-13,16H,7-11,14-15,17H2,1-6H3 |
| InChIKey | YIZAOPPXWRJEHJ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|