C25H34Cl2N2O4S — CID 83279834
[5-(diethylamino)-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83279834) has the molecular formula C25H34Cl2N2O4S and a molecular weight of 529.53 g/mol. Its IUPAC name is [5-(diethylamino)-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [5-(diethylamino)-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83279834 |
| Molecular Formula | C25H34Cl2N2O4S |
| Molecular Weight | 529.53 g/mol |
| Exact Mass | 528.16 |
| IUPAC Name | [5-(diethylamino)-2-[[2-methylpropanoyl(2-methylpropyl)amino]methyl]phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CC(C)C)C(=O)C(C)C)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C25H34Cl2N2O4S/c1-7-28(8-2)20-10-9-19(16-29(15-17(3)4)25(30)18(5)6)24(13-20)33-34(31,32)21-11-12-22(26)23(27)14-21/h9-14,17-18H,7-8,15-16H2,1-6H3 |
| InChIKey | WYKHCUXHVARCBJ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|