C29H31Cl3N2O5S — CID 83273453
[2-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate (PubChem CID 83273453) has the molecular formula C29H31Cl3N2O5S and a molecular weight of 626.00 g/mol. Its IUPAC name is [2-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate.
| Compound Name | [2-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
|---|---|
| PubChem CID | 83273453 |
| Molecular Formula | C29H31Cl3N2O5S |
| Molecular Weight | 626.00 g/mol |
| Exact Mass | 624.10 |
| IUPAC Name | [2-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]-5-(diethylamino)phenyl] 3,4-dichlorobenzenesulfonate |
| SMILES | CCN(CC)c1ccc(CN(CC2CCCO2)C(=O)c2ccccc2Cl)c(OS(=O)(=O)c2ccc(Cl)c(Cl)c2)c1 |
| InChI | InChI=1S/C29H31Cl3N2O5S/c1-3-33(4-2)21-12-11-20(28(16-21)39-40(36,37)23-13-14-26(31)27(32)17-23)18-34(19-22-8-7-15-38-22)29(35)24-9-5-6-10-25(24)30/h5-6,9-14,16-17,22H,3-4,7-8,15,18-19H2,1-2H3 |
| InChIKey | QMQWSDMUPYUELH-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.00 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|