C25H29ClN2O6S — CID 93304394
[4-chloro-2-[[cyclobutanecarbonyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93304394) has the molecular formula C25H29ClN2O6S and a molecular weight of 521.04 g/mol. Its IUPAC name is [4-chloro-2-[[cyclobutanecarbonyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[cyclobutanecarbonyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93304394 |
| Molecular Formula | C25H29ClN2O6S |
| Molecular Weight | 521.04 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | [4-chloro-2-[[cyclobutanecarbonyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2CN(C[C@H]2CCCO2)C(=O)C2CCC2)cc1 |
| InChI | InChI=1S/C25H29ClN2O6S/c1-17(29)27-21-8-10-23(11-9-21)35(31,32)34-24-12-7-20(26)14-19(24)15-28(16-22-6-3-13-33-22)25(30)18-4-2-5-18/h7-12,14,18,22H,2-6,13,15-16H2,1H3,(H,27,29)/t22-/m1/s1 |
| InChIKey | RJTSOGKXIJWEEW-JOCHJYFZSA-N |
| XLogP | 4.37 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.04 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|