C24H29ClN2O6S — CID 93304334
[4-chloro-2-[[2-methylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate (PubChem CID 93304334) has the molecular formula C24H29ClN2O6S and a molecular weight of 509.02 g/mol. Its IUPAC name is [4-chloro-2-[[2-methylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate.
| Compound Name | [4-chloro-2-[[2-methylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
|---|---|
| PubChem CID | 93304334 |
| Molecular Formula | C24H29ClN2O6S |
| Molecular Weight | 509.02 g/mol |
| Exact Mass | 508.14 |
| IUPAC Name | [4-chloro-2-[[2-methylpropanoyl-[[(2R)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-acetamidobenzenesulfonate |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Oc2ccc(Cl)cc2CN(C[C@H]2CCCO2)C(=O)C(C)C)cc1 |
| InChI | InChI=1S/C24H29ClN2O6S/c1-16(2)24(29)27(15-21-5-4-12-32-21)14-18-13-19(25)6-11-23(18)33-34(30,31)22-9-7-20(8-10-22)26-17(3)28/h6-11,13,16,21H,4-5,12,14-15H2,1-3H3,(H,26,28)/t21-/m1/s1 |
| InChIKey | GVZYFJWUWKPUAG-OAQYLSRUSA-N |
| XLogP | 4.23 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.02 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|