C25H23F2NO5S — CID 93301803
[2-[[(2-fluorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 93301803) has the molecular formula C25H23F2NO5S and a molecular weight of 487.52 g/mol. Its IUPAC name is [2-[[(2-fluorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [2-[[(2-fluorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 93301803 |
| Molecular Formula | C25H23F2NO5S |
| Molecular Weight | 487.52 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | [2-[[(2-fluorobenzoyl)-[[(2S)-oxolan-2-yl]methyl]amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(c1ccccc1F)N(Cc1ccccc1OS(=O)(=O)c1ccc(F)cc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C25H23F2NO5S/c26-19-11-13-21(14-12-19)34(30,31)33-24-10-4-1-6-18(24)16-28(17-20-7-5-15-32-20)25(29)22-8-2-3-9-23(22)27/h1-4,6,8-14,20H,5,7,15-17H2/t20-/m0/s1 |
| InChIKey | NWSBTJHMIWWHBE-FQEVSTJZSA-N |
| XLogP | 4.55 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.52 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|