C19H19BrFNO2 — CID 19120010
2-bromo-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 19120010) has the molecular formula C19H19BrFNO2 and a molecular weight of 392.27 g/mol. Its IUPAC name is 2-bromo-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-bromo-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 19120010 |
| Molecular Formula | C19H19BrFNO2 |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | 2-bromo-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(c1ccccc1Br)N(Cc1ccccc1F)CC1CCCO1 |
| InChI | InChI=1S/C19H19BrFNO2/c20-17-9-3-2-8-16(17)19(23)22(13-15-7-5-11-24-15)12-14-6-1-4-10-18(14)21/h1-4,6,8-10,15H,5,7,11-13H2 |
| InChIKey | GJYZQLQQHAJDET-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |