C20H21BrFNO3 — CID 19120014
2-(4-bromophenoxy)-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 19120014) has the molecular formula C20H21BrFNO3 and a molecular weight of 422.29 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 19120014 |
| Molecular Formula | C20H21BrFNO3 |
| Molecular Weight | 422.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[(2-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)N(Cc1ccccc1F)CC1CCCO1 |
| InChI | InChI=1S/C20H21BrFNO3/c21-16-7-9-17(10-8-16)26-14-20(24)23(13-18-5-3-11-25-18)12-15-4-1-2-6-19(15)22/h1-2,4,6-10,18H,3,5,11-14H2 |
| InChIKey | FISDZDPSDVMDMI-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |